C38H42O4 — CID 100970086
6-(2,5-dihexoxyphenyl)-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol (PubChem CID 100970086) has the molecular formula C38H42O4 and a molecular weight of 562.75 g/mol. Its IUPAC name is 6-(2,5-dihexoxyphenyl)-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol.
| Compound Name | 6-(2,5-dihexoxyphenyl)-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 100970086 |
| Molecular Formula | C38H42O4 |
| Molecular Weight | 562.75 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | 6-(2,5-dihexoxyphenyl)-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
| SMILES | CCCCCCOc1ccc(OCCCCCC)c(-c2ccc3c(-c4c(O)ccc5ccccc45)c(O)ccc3c2)c1 |
| InChI | InChI=1S/C38H42O4/c1-3-5-7-11-23-41-30-18-22-36(42-24-12-8-6-4-2)33(26-30)29-15-19-32-28(25-29)17-21-35(40)38(32)37-31-14-10-9-13-27(31)16-20-34(37)39/h9-10,13-22,25-26,39-40H,3-8,11-12,23-24H2,1-2H3 |
| InChIKey | BTOGQFUYOUWFEF-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.75 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|