C23H30N4O8 — CID 10097095
(4S)-5-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-4-[[2-[[4-[(E)-2-carboxyethenyl]benzoyl]amino]acetyl]amino]-5-oxopentanoic acid (PubChem CID 10097095) has the molecular formula C23H30N4O8 and a molecular weight of 490.51 g/mol. Its IUPAC name is (4S)-5-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-4-[[2-[[4-[(E)-2-carboxyethenyl]benzoyl]amino]acetyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-4-[[2-[[4-[(E)-2-carboxyethenyl]benzoyl]amino]acetyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10097095 |
| Molecular Formula | C23H30N4O8 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | (4S)-5-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-4-[[2-[[4-[(E)-2-carboxyethenyl]benzoyl]amino]acetyl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)CNC(=O)c1ccc(/C=C/C(=O)O)cc1)C(N)=O |
| InChI | InChI=1S/C23H30N4O8/c1-13(2)11-17(21(24)33)27-23(35)16(8-10-20(31)32)26-18(28)12-25-22(34)15-6-3-14(4-7-15)5-9-19(29)30/h3-7,9,13,16-17H,8,10-12H2,1-2H3,(H2,24,33)(H,25,34)(H,26,28)(H,27,35)(H,29,30)(H,31,32)/b9-5+/t16-,17-/m0/s1 |
| InChIKey | FLSKQXVPDPVSQX-ZTXDWSKGSA-N |
| XLogP | -0.12 |
| TPSA | 204.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|