C18H30O4 — CID 100972440
[(2R)-2,3-dihydroxypropyl] (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate (PubChem CID 100972440) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate.
| Compound Name | [(2R)-2,3-dihydroxypropyl] (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate |
|---|---|
| PubChem CID | 100972440 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(=O)OC[C@H](O)CO |
| InChI | InChI=1S/C18H30O4/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-18(21)22-13-17(20)12-19/h7,9,11,17,19-20H,5-6,8,10,12-13H2,1-4H3/b15-9+,16-11+/t17-/m1/s1 |
| InChIKey | LPCGEFKEAAGXRE-UINNIIOQSA-N |
| XLogP | 3.30 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|