C17H28O5 — CID 10519195
[(2S)-3-hydroxy-2-(3-methylbut-2-enoyloxy)propyl] 4-methyl-3-propan-2-ylpent-2-enoate (PubChem CID 10519195) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is [(2S)-3-hydroxy-2-(3-methylbut-2-enoyloxy)propyl] 4-methyl-3-propan-2-ylpent-2-enoate.
| Compound Name | [(2S)-3-hydroxy-2-(3-methylbut-2-enoyloxy)propyl] 4-methyl-3-propan-2-ylpent-2-enoate |
|---|---|
| PubChem CID | 10519195 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [(2S)-3-hydroxy-2-(3-methylbut-2-enoyloxy)propyl] 4-methyl-3-propan-2-ylpent-2-enoate |
| SMILES | CC(C)=CC(=O)O[C@@H](CO)COC(=O)C=C(C(C)C)C(C)C |
| InChI | InChI=1S/C17H28O5/c1-11(2)7-17(20)22-14(9-18)10-21-16(19)8-15(12(3)4)13(5)6/h7-8,12-14,18H,9-10H2,1-6H3/t14-/m0/s1 |
| InChIKey | LGDVAJMMQSPBGB-AWEZNQCLSA-N |
| XLogP | 2.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|