About 3-[(3S)-5,5-dimethylhex-1-en-3-yl]thiophene
3-[(3S)-5,5-dimethylhex-1-en-3-yl]thiophene (PubChem CID 100973089) has the molecular formula C12H18S
and a molecular weight of 194.34 g/mol. Its IUPAC name is 3-[(3S)-5,5-dimethylhex-1-en-3-yl]thiophene.
Molecular Properties
| Compound Name | 3-[(3S)-5,5-dimethylhex-1-en-3-yl]thiophene |
| PubChem CID | 100973089 |
| Molecular Formula | C12H18S |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 3-[(3S)-5,5-dimethylhex-1-en-3-yl]thiophene |
| SMILES | C=C[C@H](CC(C)(C)C)c1ccsc1 |
| InChI | InChI=1S/C12H18S/c1-5-10(8-12(2,3)4)11-6-7-13-9-11/h5-7,9-10H,1,8H2,2-4H3/t10-/m1/s1 |
| InChIKey | TUMKOESVLKGLER-SNVBAGLBSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3S)-5,5-dimethylhex-1-en-3-yl]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3S)-5,5-dimethylhex-1-en-3-yl]thiophene?
The IUPAC name of 3-[(3S)-5,5-dimethylhex-1-en-3-yl]thiophene (CID 100973089) is 3-[(3S)-5,5-dimethylhex-1-en-3-yl]thiophene.
What is the SMILES notation for 3-[(3S)-5,5-dimethylhex-1-en-3-yl]thiophene?
The canonical SMILES for 3-[(3S)-5,5-dimethylhex-1-en-3-yl]thiophene is C=C[C@H](CC(C)(C)C)c1ccsc1.
What is the InChIKey of 3-[(3S)-5,5-dimethylhex-1-en-3-yl]thiophene?
The InChIKey is TUMKOESVLKGLER-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H18S/c1-5-10(8-12(2,3)4)11-6-7-13-9-11/h5-7,9-10H,1,8H2,2-4H3/t10-/m1/s1.
What are the key properties of 3-[(3S)-5,5-dimethylhex-1-en-3-yl]thiophene?
3-[(3S)-5,5-dimethylhex-1-en-3-yl]thiophene has a molecular weight of 194.34 g/mol, XLogP of 4.45, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3S)-5,5-dimethylhex-1-en-3-yl]thiophene is sourced from PubChem (CID 100973089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).