C13H16O — CID 100973323
(S)-phenyl-[(1S,2S)-2-prop-1-en-2-ylcyclopropyl]methanol (PubChem CID 100973323) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is (S)-phenyl-[(1S,2S)-2-prop-1-en-2-ylcyclopropyl]methanol.
| Compound Name | (S)-phenyl-[(1S,2S)-2-prop-1-en-2-ylcyclopropyl]methanol |
|---|---|
| PubChem CID | 100973323 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (S)-phenyl-[(1S,2S)-2-prop-1-en-2-ylcyclopropyl]methanol |
| SMILES | C=C(C)[C@H]1C[C@@H]1[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C13H16O/c1-9(2)11-8-12(11)13(14)10-6-4-3-5-7-10/h3-7,11-14H,1,8H2,2H3/t11-,12+,13-/m1/s1 |
| InChIKey | KMIVVGYQBOOSTF-FRRDWIJNSA-N |
| XLogP | 2.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|