C9H16O — CID 73094340
1-(2-prop-1-en-2-ylcyclopropyl)propan-1-ol (PubChem CID 73094340) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is 1-(2-prop-1-en-2-ylcyclopropyl)propan-1-ol.
| Compound Name | 1-(2-prop-1-en-2-ylcyclopropyl)propan-1-ol |
|---|---|
| PubChem CID | 73094340 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 1-(2-prop-1-en-2-ylcyclopropyl)propan-1-ol |
| SMILES | C=C(C)C1CC1C(O)CC |
| InChI | InChI=1S/C9H16O/c1-4-9(10)8-5-7(8)6(2)3/h7-10H,2,4-5H2,1,3H3 |
| InChIKey | BTMGONFNGWZDSI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|