C17H24O4 — CID 100977436
dimethyl (3aS,8aS)-4-propan-2-ylidene-1,3,3a,5,6,8a-hexahydroazulene-2,2-dicarboxylate (PubChem CID 100977436) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is dimethyl (3aS,8aS)-4-propan-2-ylidene-1,3,3a,5,6,8a-hexahydroazulene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aS,8aS)-4-propan-2-ylidene-1,3,3a,5,6,8a-hexahydroazulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 100977436 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | dimethyl (3aS,8aS)-4-propan-2-ylidene-1,3,3a,5,6,8a-hexahydroazulene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H]2C=CCCC(=C(C)C)[C@H]2C1 |
| InChI | InChI=1S/C17H24O4/c1-11(2)13-8-6-5-7-12-9-17(10-14(12)13,15(18)20-3)16(19)21-4/h5,7,12,14H,6,8-10H2,1-4H3/t12-,14+/m1/s1 |
| InChIKey | CKNCWOALQDCYKJ-OCCSQVGLSA-N |
| XLogP | 3.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|