C27H41N3O6 — CID 100977462
N-[(4aR,6R,7R,8R,8aS)-6-cyclohexyloxy-8-[4-(2-hydroxyethyl)piperazin-1-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (PubChem CID 100977462) has the molecular formula C27H41N3O6 and a molecular weight of 503.64 g/mol. Its IUPAC name is N-[(4aR,6R,7R,8R,8aS)-6-cyclohexyloxy-8-[4-(2-hydroxyethyl)piperazin-1-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide.
| Compound Name | N-[(4aR,6R,7R,8R,8aS)-6-cyclohexyloxy-8-[4-(2-hydroxyethyl)piperazin-1-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
|---|---|
| PubChem CID | 100977462 |
| Molecular Formula | C27H41N3O6 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | N-[(4aR,6R,7R,8R,8aS)-6-cyclohexyloxy-8-[4-(2-hydroxyethyl)piperazin-1-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@H](OC2CCCCC2)O[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H]1N1CCN(CCO)CC1 |
| InChI | InChI=1S/C27H41N3O6/c1-19(32)28-23-24(30-14-12-29(13-15-30)16-17-31)25-22(35-27(23)34-21-10-6-3-7-11-21)18-33-26(36-25)20-8-4-2-5-9-20/h2,4-5,8-9,21-27,31H,3,6-7,10-18H2,1H3,(H,28,32)/t22-,23-,24-,25-,26?,27-/m1/s1 |
| InChIKey | HCHQADKUUSTPQR-UCOBTGRVSA-N |
| XLogP | 1.66 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |