C55H106N10O13 — CID 100977480
2-[[(2S)-2-[bis[3-[[(2S)-2-[bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]-3-methylbutanoyl]amino]propyl]amino]-3-methylbutanoyl]amino]acetic acid (PubChem CID 100977480) has the molecular formula C55H106N10O13 and a molecular weight of 1115.51 g/mol. Its IUPAC name is 2-[[(2S)-2-[bis[3-[[(2S)-2-[bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]-3-methylbutanoyl]amino]propyl]amino]-3-methylbutanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-2-[bis[3-[[(2S)-2-[bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]-3-methylbutanoyl]amino]propyl]amino]-3-methylbutanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 100977480 |
| Molecular Formula | C55H106N10O13 |
| Molecular Weight | 1115.51 g/mol |
| Exact Mass | 1114.79 |
| IUPAC Name | 2-[[(2S)-2-[bis[3-[[(2S)-2-[bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]-3-methylbutanoyl]amino]propyl]amino]-3-methylbutanoyl]amino]acetic acid |
| SMILES | CC(C)[C@@H](C(=O)NCCCN(CCCNC(=O)[C@H](C(C)C)N(CCCNC(=O)OC(C)(C)C)CCCNC(=O)OC(C)(C)C)[C@H](C(=O)NCC(=O)O)C(C)C)N(CCCNC(=O)OC(C)(C)C)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C55H106N10O13/c1-38(2)42(63(33-21-27-58-48(71)75-52(7,8)9)34-22-28-59-49(72)76-53(10,11)12)45(68)56-25-19-31-65(44(40(5)6)47(70)62-37-41(66)67)32-20-26-57-46(69)43(39(3)4)64(35-23-29-60-50(73)77-54(13,14)15)36-24-30-61-51(74)78-55(16,17)18/h38-40,42-44H,19-37H2,1-18H3,(H,56,68)(H,57,69)(H,58,71)(H,59,72)(H,60,73)(H,61,74)(H,62,70)(H,66,67)/t42-,43-,44-/m0/s1 |
| InChIKey | MAZXIUBQOSZUTO-KJFLPAQCSA-N |
| XLogP | 5.84 |
| TPSA | 287.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 78 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1115.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|