C18H36O2 — CID 100979695
[(2R,3R,7R,9R)-3,7,9-trimethyltridecan-2-yl] acetate (PubChem CID 100979695) has the molecular formula C18H36O2 and a molecular weight of 284.48 g/mol. Its IUPAC name is [(2R,3R,7R,9R)-3,7,9-trimethyltridecan-2-yl] acetate.
| Compound Name | [(2R,3R,7R,9R)-3,7,9-trimethyltridecan-2-yl] acetate |
|---|---|
| PubChem CID | 100979695 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | [(2R,3R,7R,9R)-3,7,9-trimethyltridecan-2-yl] acetate |
| SMILES | CCCC[C@@H](C)C[C@H](C)CCC[C@@H](C)[C@@H](C)OC(C)=O |
| InChI | InChI=1S/C18H36O2/c1-7-8-10-14(2)13-15(3)11-9-12-16(4)17(5)20-18(6)19/h14-17H,7-13H2,1-6H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | VRXKTFVMEPQYFO-QBPKDAKJSA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |