C15H10O — CID 100980527
10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,11,13-heptaene (PubChem CID 100980527) has the molecular formula C15H10O and a molecular weight of 206.24 g/mol. Its IUPAC name is 10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,11,13-heptaene.
| Compound Name | 10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,11,13-heptaene |
|---|---|
| PubChem CID | 100980527 |
| Molecular Formula | C15H10O |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,11,13-heptaene |
| SMILES | C1=Cc2coc3cc4ccccc4c(c23)C1 |
| InChI | InChI=1S/C15H10O/c1-2-6-12-10(4-1)8-14-15-11(9-16-14)5-3-7-13(12)15/h1-6,8-9H,7H2 |
| InChIKey | JMHJZXHZQDYKJP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |