C18H36O5 — CID 100981042
ethyl (2R,4S)-4-(2-methoxyethoxymethoxy)-6-methyl-2-(2-methylpropyl)heptanoate (PubChem CID 100981042) has the molecular formula C18H36O5 and a molecular weight of 332.48 g/mol. Its IUPAC name is ethyl (2R,4S)-4-(2-methoxyethoxymethoxy)-6-methyl-2-(2-methylpropyl)heptanoate.
| Compound Name | ethyl (2R,4S)-4-(2-methoxyethoxymethoxy)-6-methyl-2-(2-methylpropyl)heptanoate |
|---|---|
| PubChem CID | 100981042 |
| Molecular Formula | C18H36O5 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | ethyl (2R,4S)-4-(2-methoxyethoxymethoxy)-6-methyl-2-(2-methylpropyl)heptanoate |
| SMILES | CCOC(=O)C(CC(C)C)C[C@H](CC(C)C)OCOCCOC |
| InChI | InChI=1S/C18H36O5/c1-7-22-18(19)16(10-14(2)3)12-17(11-15(4)5)23-13-21-9-8-20-6/h14-17H,7-13H2,1-6H3/t16?,17-/m0/s1 |
| InChIKey | XWNJPOAHXPYXKD-DJNXLDHESA-N |
| XLogP | 3.65 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|