C26H27N5O5S — CID 10098218
N-(2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl)-1-hydroxy-4-[(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)methylamino]cyclohexane-1-carboxamide (PubChem CID 10098218) has the molecular formula C26H27N5O5S and a molecular weight of 521.60 g/mol. Its IUPAC name is N-(2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl)-1-hydroxy-4-[(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)methylamino]cyclohexane-1-carboxamide.
| Compound Name | N-(2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl)-1-hydroxy-4-[(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)methylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 10098218 |
| Molecular Formula | C26H27N5O5S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | N-(2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl)-1-hydroxy-4-[(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)methylamino]cyclohexane-1-carboxamide |
| SMILES | O=C1CSc2ccc(CNC3CCC(O)(C(=O)Nc4ccnc5ccc6c(c45)OCCO6)CC3)nc2N1 |
| InChI | InChI=1S/C26H27N5O5S/c32-21-14-37-20-4-1-16(29-24(20)31-21)13-28-15-5-8-26(34,9-6-15)25(33)30-18-7-10-27-17-2-3-19-23(22(17)18)36-12-11-35-19/h1-4,7,10,15,28,34H,5-6,8-9,11-14H2,(H,27,30,33)(H,29,31,32) |
| InChIKey | WQWZOEIBPGKVLL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 134.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |