C27H30N4O5 — CID 44536952
6-[[[4-[2-(2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-9-yl)ethyl]-4-hydroxycyclohexyl]amino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 44536952) has the molecular formula C27H30N4O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is 6-[[[4-[2-(2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-9-yl)ethyl]-4-hydroxycyclohexyl]amino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-[[[4-[2-(2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-9-yl)ethyl]-4-hydroxycyclohexyl]amino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 44536952 |
| Molecular Formula | C27H30N4O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 6-[[[4-[2-(2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-9-yl)ethyl]-4-hydroxycyclohexyl]amino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | O=C1COc2ccc(CNC3CCC(O)(CCc4ccnc5cc6c(cc45)OCCO6)CC3)nc2N1 |
| InChI | InChI=1S/C27H30N4O5/c32-25-16-36-22-2-1-19(30-26(22)31-25)15-29-18-4-8-27(33,9-5-18)7-3-17-6-10-28-21-14-24-23(13-20(17)21)34-11-12-35-24/h1-2,6,10,13-14,18,29,33H,3-5,7-9,11-12,15-16H2,(H,30,31,32) |
| InChIKey | ZZBWCZNCEDMGQM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |