C25H30ClN5O3 — CID 44536892
6-[[2-[1-(6-methoxyquinolin-4-yl)piperidin-4-yl]ethylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride (PubChem CID 44536892) has the molecular formula C25H30ClN5O3 and a molecular weight of 484.00 g/mol. Its IUPAC name is 6-[[2-[1-(6-methoxyquinolin-4-yl)piperidin-4-yl]ethylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride.
| Compound Name | 6-[[2-[1-(6-methoxyquinolin-4-yl)piperidin-4-yl]ethylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride |
|---|---|
| PubChem CID | 44536892 |
| Molecular Formula | C25H30ClN5O3 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 6-[[2-[1-(6-methoxyquinolin-4-yl)piperidin-4-yl]ethylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride |
| SMILES | COc1ccc2nccc(N3CCC(CCNCc4ccc5c(n4)NC(=O)CO5)CC3)c2c1.Cl |
| InChI | InChI=1S/C25H29N5O3.ClH/c1-32-19-3-4-21-20(14-19)22(7-11-27-21)30-12-8-17(9-13-30)6-10-26-15-18-2-5-23-25(28-18)29-24(31)16-33-23;/h2-5,7,11,14,17,26H,6,8-10,12-13,15-16H2,1H3,(H,28,29,31);1H |
| InChIKey | LPSRGIIHGOTXRR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|