C23H27N7O3 — CID 90732223
6-[[2-[4-(6-methoxycinnolin-4-yl)piperazin-1-yl]ethylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 90732223) has the molecular formula C23H27N7O3 and a molecular weight of 449.52 g/mol. Its IUPAC name is 6-[[2-[4-(6-methoxycinnolin-4-yl)piperazin-1-yl]ethylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-[[2-[4-(6-methoxycinnolin-4-yl)piperazin-1-yl]ethylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 90732223 |
| Molecular Formula | C23H27N7O3 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 6-[[2-[4-(6-methoxycinnolin-4-yl)piperazin-1-yl]ethylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | COc1ccc2nncc(N3CCN(CCNCc4ccc5c(n4)NC(=O)CO5)CC3)c2c1 |
| InChI | InChI=1S/C23H27N7O3/c1-32-17-3-4-19-18(12-17)20(14-25-28-19)30-10-8-29(9-11-30)7-6-24-13-16-2-5-21-23(26-16)27-22(31)15-33-21/h2-5,12,14,24H,6-11,13,15H2,1H3,(H,26,27,31) |
| InChIKey | JXIJQGZSJNJNCN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|