C35H54O3 — CID 10098263
1,13-dihydroxy-2,12-dimethyl-2,12-bis[4-(2-methylpropyl)phenyl]tridecan-7-one (PubChem CID 10098263) has the molecular formula C35H54O3 and a molecular weight of 522.81 g/mol. Its IUPAC name is 1,13-dihydroxy-2,12-dimethyl-2,12-bis[4-(2-methylpropyl)phenyl]tridecan-7-one.
| Compound Name | 1,13-dihydroxy-2,12-dimethyl-2,12-bis[4-(2-methylpropyl)phenyl]tridecan-7-one |
|---|---|
| PubChem CID | 10098263 |
| Molecular Formula | C35H54O3 |
| Molecular Weight | 522.81 g/mol |
| Exact Mass | 522.41 |
| IUPAC Name | 1,13-dihydroxy-2,12-dimethyl-2,12-bis[4-(2-methylpropyl)phenyl]tridecan-7-one |
| SMILES | CC(C)Cc1ccc(C(C)(CO)CCCCC(=O)CCCCC(C)(CO)c2ccc(CC(C)C)cc2)cc1 |
| InChI | InChI=1S/C35H54O3/c1-27(2)23-29-13-17-31(18-14-29)34(5,25-36)21-9-7-11-33(38)12-8-10-22-35(6,26-37)32-19-15-30(16-20-32)24-28(3)4/h13-20,27-28,36-37H,7-12,21-26H2,1-6H3 |
| InChIKey | HGJKCTNNEWONAW-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.81 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|