C17H20O2 — CID 100982876
3-(phenylmethoxymethyl)-1,4,5,6,7,7a-hexahydroinden-2-one (PubChem CID 100982876) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 3-(phenylmethoxymethyl)-1,4,5,6,7,7a-hexahydroinden-2-one.
| Compound Name | 3-(phenylmethoxymethyl)-1,4,5,6,7,7a-hexahydroinden-2-one |
|---|---|
| PubChem CID | 100982876 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 3-(phenylmethoxymethyl)-1,4,5,6,7,7a-hexahydroinden-2-one |
| SMILES | O=C1CC2CCCCC2=C1COCc1ccccc1 |
| InChI | InChI=1S/C17H20O2/c18-17-10-14-8-4-5-9-15(14)16(17)12-19-11-13-6-2-1-3-7-13/h1-3,6-7,14H,4-5,8-12H2 |
| InChIKey | VXCOKRNDTKVVQD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |