C12H18O — CID 102337325
3-propyl-1,4,5,6,7,7a-hexahydroinden-2-one (PubChem CID 102337325) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 3-propyl-1,4,5,6,7,7a-hexahydroinden-2-one.
| Compound Name | 3-propyl-1,4,5,6,7,7a-hexahydroinden-2-one |
|---|---|
| PubChem CID | 102337325 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 3-propyl-1,4,5,6,7,7a-hexahydroinden-2-one |
| SMILES | CCCC1=C2CCCCC2CC1=O |
| InChI | InChI=1S/C12H18O/c1-2-5-11-10-7-4-3-6-9(10)8-12(11)13/h9H,2-8H2,1H3 |
| InChIKey | WJXQHCNYALWONT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |