C13H18O2 — CID 163741109
4-(3-oxobutyl)-1,2,3,6,7,7a-hexahydroinden-5-one (PubChem CID 163741109) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 4-(3-oxobutyl)-1,2,3,6,7,7a-hexahydroinden-5-one.
| Compound Name | 4-(3-oxobutyl)-1,2,3,6,7,7a-hexahydroinden-5-one |
|---|---|
| PubChem CID | 163741109 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 4-(3-oxobutyl)-1,2,3,6,7,7a-hexahydroinden-5-one |
| SMILES | CC(=O)CCC1=C2CCCC2CCC1=O |
| InChI | InChI=1S/C13H18O2/c1-9(14)5-7-12-11-4-2-3-10(11)6-8-13(12)15/h10H,2-8H2,1H3 |
| InChIKey | LHUKBZGULFWOGK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |