C12H13NO9S — CID 100983751
(2S,3R,5R,6E)-3-(acetyloxymethyl)-6-(carboxymethylidene)-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 100983751) has the molecular formula C12H13NO9S and a molecular weight of 347.30 g/mol. Its IUPAC name is (2S,3R,5R,6E)-3-(acetyloxymethyl)-6-(carboxymethylidene)-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,3R,5R,6E)-3-(acetyloxymethyl)-6-(carboxymethylidene)-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 100983751 |
| Molecular Formula | C12H13NO9S |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | (2S,3R,5R,6E)-3-(acetyloxymethyl)-6-(carboxymethylidene)-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC(=O)OC[C@@]1(C)[C@H](C(=O)O)N2C(=O)/C(=C\C(=O)O)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C12H13NO9S/c1-5(14)22-4-12(2)8(11(18)19)13-9(17)6(3-7(15)16)10(13)23(12,20)21/h3,8,10H,4H2,1-2H3,(H,15,16)(H,18,19)/b6-3+/t8-,10+,12-/m0/s1 |
| InChIKey | WNSVUMZKPWSNSA-CDPFFCNHSA-N |
| XLogP | -1.63 |
| TPSA | 155.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|