C11H9NO9S-2 — CID 91931140
(2S,3R,6Z)-6-(carboxylatomethylidene)-3-(formyloxymethyl)-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 91931140) has the molecular formula C11H9NO9S-2 and a molecular weight of 331.26 g/mol. Its IUPAC name is (2S,3R,6Z)-6-(carboxylatomethylidene)-3-(formyloxymethyl)-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (2S,3R,6Z)-6-(carboxylatomethylidene)-3-(formyloxymethyl)-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 91931140 |
| Molecular Formula | C11H9NO9S-2 |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | (2S,3R,6Z)-6-(carboxylatomethylidene)-3-(formyloxymethyl)-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@]1(COC=O)[C@H](C(=O)[O-])N2C(=O)/C(=C/C(=O)[O-])C2S1(=O)=O |
| InChI | InChI=1S/C11H11NO9S/c1-11(3-21-4-13)7(10(17)18)12-8(16)5(2-6(14)15)9(12)22(11,19)20/h2,4,7,9H,3H2,1H3,(H,14,15)(H,17,18)/p-2/b5-2-/t7-,9?,11-/m0/s1 |
| InChIKey | IZCVSQGCGANHMW-PNPFSWGZSA-L |
| XLogP | -4.69 |
| TPSA | 161.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | -4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|