C21H28O8 — CID 100984359
[(1R,2S,3S,6S,7S,8S,9R,10R,13S)-9-hydroxy-6-(methoxymethyl)-13-methyl-5,11-dioxo-4,12-dioxatetracyclo[8.5.0.02,13.03,7]pentadecan-8-yl] (Z)-2-methylbut-2-enoate (PubChem CID 100984359) has the molecular formula C21H28O8 and a molecular weight of 408.45 g/mol. Its IUPAC name is [(1R,2S,3S,6S,7S,8S,9R,10R,13S)-9-hydroxy-6-(methoxymethyl)-13-methyl-5,11-dioxo-4,12-dioxatetracyclo[8.5.0.02,13.03,7]pentadecan-8-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,2S,3S,6S,7S,8S,9R,10R,13S)-9-hydroxy-6-(methoxymethyl)-13-methyl-5,11-dioxo-4,12-dioxatetracyclo[8.5.0.02,13.03,7]pentadecan-8-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 100984359 |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [(1R,2S,3S,6S,7S,8S,9R,10R,13S)-9-hydroxy-6-(methoxymethyl)-13-methyl-5,11-dioxo-4,12-dioxatetracyclo[8.5.0.02,13.03,7]pentadecan-8-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@@H]1[C@H](O)[C@@H]2C(=O)O[C@@]3(C)CC[C@@H]2[C@H]3[C@H]2OC(=O)[C@H](COC)[C@H]12 |
| InChI | InChI=1S/C21H28O8/c1-5-9(2)18(23)28-17-13-11(8-26-4)19(24)27-16(13)14-10-6-7-21(14,3)29-20(25)12(10)15(17)22/h5,10-17,22H,6-8H2,1-4H3/b9-5-/t10-,11+,12+,13-,14-,15+,16-,17-,21-/m0/s1 |
| InChIKey | CVTYFBQEYQCBTF-VGZJETSOSA-N |
| XLogP | 1.00 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|