C12H29NP2SSe — CID 100984496
2-[[di(propan-2-yl)phosphinoselenoylamino]-propan-2-ylphosphinothioyl]propane (PubChem CID 100984496) has the molecular formula C12H29NP2SSe and a molecular weight of 360.35 g/mol. Its IUPAC name is 2-[[di(propan-2-yl)phosphinoselenoylamino]-propan-2-ylphosphinothioyl]propane.
| Compound Name | 2-[[di(propan-2-yl)phosphinoselenoylamino]-propan-2-ylphosphinothioyl]propane |
|---|---|
| PubChem CID | 100984496 |
| Molecular Formula | C12H29NP2SSe |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-[[di(propan-2-yl)phosphinoselenoylamino]-propan-2-ylphosphinothioyl]propane |
| SMILES | CC(C)P(=S)(NP(=[Se])(C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C12H29NP2SSe/c1-9(2)14(16,10(3)4)13-15(17,11(5)6)12(7)8/h9-12H,1-8H3,(H,13,16,17) |
| InChIKey | WYLYJGFACQTQEK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|