C12H29NP2S2 — CID 87562223
1-[(dipropylphosphinothioylamino)-propylphosphinothioyl]propane (PubChem CID 87562223) has the molecular formula C12H29NP2S2 and a molecular weight of 313.45 g/mol. Its IUPAC name is 1-[(dipropylphosphinothioylamino)-propylphosphinothioyl]propane.
| Compound Name | 1-[(dipropylphosphinothioylamino)-propylphosphinothioyl]propane |
|---|---|
| PubChem CID | 87562223 |
| Molecular Formula | C12H29NP2S2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 1-[(dipropylphosphinothioylamino)-propylphosphinothioyl]propane |
| SMILES | CCCP(=S)(CCC)NP(=S)(CCC)CCC |
| InChI | InChI=1S/C12H29NP2S2/c1-5-9-14(16,10-6-2)13-15(17,11-7-3)12-8-4/h5-12H2,1-4H3,(H,13,16,17) |
| InChIKey | MWZJJQUAYBYYPQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|