About sodium dibutyl-oxido-sulfanylidene-λ5-phosphane
sodium dibutyl-oxido-sulfanylidene-λ5-phosphane (PubChem CID 23690563) has the molecular formula C8H18NaOPS
and a molecular weight of 216.26 g/mol. Its IUPAC name is sodium dibutyl-oxido-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | sodium dibutyl-oxido-sulfanylidene-λ5-phosphane |
| PubChem CID | 23690563 |
| Molecular Formula | C8H18NaOPS |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | sodium dibutyl-oxido-sulfanylidene-λ5-phosphane |
| SMILES | CCCCP([O-])(=S)CCCC.[Na+] |
| InChI | InChI=1S/C8H19OPS.Na/c1-3-5-7-10(9,11)8-6-4-2;/h3-8H2,1-2H3,(H,9,11);/q;+1/p-1 |
| InChIKey | POZHJULZJSCJNJ-UHFFFAOYSA-M |
| XLogP | -0.65 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium dibutyl-oxido-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium dibutyl-oxido-sulfanylidene-λ5-phosphane?
The IUPAC name of sodium dibutyl-oxido-sulfanylidene-λ5-phosphane (CID 23690563) is sodium dibutyl-oxido-sulfanylidene-λ5-phosphane.
What is the SMILES notation for sodium dibutyl-oxido-sulfanylidene-λ5-phosphane?
The canonical SMILES for sodium dibutyl-oxido-sulfanylidene-λ5-phosphane is CCCCP([O-])(=S)CCCC.[Na+].
What is the InChIKey of sodium dibutyl-oxido-sulfanylidene-λ5-phosphane?
The InChIKey is POZHJULZJSCJNJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H19OPS.Na/c1-3-5-7-10(9,11)8-6-4-2;/h3-8H2,1-2H3,(H,9,11);/q;+1/p-1.
What are the key properties of sodium dibutyl-oxido-sulfanylidene-λ5-phosphane?
sodium dibutyl-oxido-sulfanylidene-λ5-phosphane has a molecular weight of 216.26 g/mol, XLogP of -0.65, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium dibutyl-oxido-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 23690563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).