C20H22N2O2 — CID 100984929
(2R,5S)-2,5-dibenzyl-3,6-dimethoxy-2,5-dihydropyrazine (PubChem CID 100984929) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (2R,5S)-2,5-dibenzyl-3,6-dimethoxy-2,5-dihydropyrazine.
| Compound Name | (2R,5S)-2,5-dibenzyl-3,6-dimethoxy-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 100984929 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (2R,5S)-2,5-dibenzyl-3,6-dimethoxy-2,5-dihydropyrazine |
| SMILES | COC1=N[C@H](Cc2ccccc2)C(OC)=N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H22N2O2/c1-23-19-17(13-15-9-5-3-6-10-15)22-20(24-2)18(21-19)14-16-11-7-4-8-12-16/h3-12,17-18H,13-14H2,1-2H3/t17-,18+ |
| InChIKey | OGAATMYUPQAPEC-HDICACEKSA-N |
| XLogP | 3.31 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |