C20H17F5N2O2 — CID 100984930
(2S,5R)-2-benzyl-3,6-dimethoxy-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-2,5-dihydropyrazine (PubChem CID 100984930) has the molecular formula C20H17F5N2O2 and a molecular weight of 412.36 g/mol. Its IUPAC name is (2S,5R)-2-benzyl-3,6-dimethoxy-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-2,5-dihydropyrazine.
| Compound Name | (2S,5R)-2-benzyl-3,6-dimethoxy-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 100984930 |
| Molecular Formula | C20H17F5N2O2 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (2S,5R)-2-benzyl-3,6-dimethoxy-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-2,5-dihydropyrazine |
| SMILES | COC1=N[C@H](Cc2c(F)c(F)c(F)c(F)c2F)C(OC)=N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H17F5N2O2/c1-28-19-12(8-10-6-4-3-5-7-10)26-20(29-2)13(27-19)9-11-14(21)16(23)18(25)17(24)15(11)22/h3-7,12-13H,8-9H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | AGHPBWBFRUQKFT-QWHCGFSZSA-N |
| XLogP | 4.01 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|