C18H35NO3Si — CID 100985226
tert-butyl N-[(3S)-5-methyl-1-oxo-2-triethylsilylhex-1-en-3-yl]carbamate (PubChem CID 100985226) has the molecular formula C18H35NO3Si and a molecular weight of 341.57 g/mol. Its IUPAC name is tert-butyl N-[(3S)-5-methyl-1-oxo-2-triethylsilylhex-1-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-5-methyl-1-oxo-2-triethylsilylhex-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 100985226 |
| Molecular Formula | C18H35NO3Si |
| Molecular Weight | 341.57 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | tert-butyl N-[(3S)-5-methyl-1-oxo-2-triethylsilylhex-1-en-3-yl]carbamate |
| SMILES | CC[Si](CC)(CC)C(=C=O)[C@H](CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H35NO3Si/c1-9-23(10-2,11-3)16(13-20)15(12-14(4)5)19-17(21)22-18(6,7)8/h14-15H,9-12H2,1-8H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | GSLLPBJKLHMQFA-HNNXBMFYSA-N |
| XLogP | 4.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|