C25H41NO3 — CID 100985757
1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-16-[[2-hydroxyethyl(methyl)amino]methyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 100985757) has the molecular formula C25H41NO3 and a molecular weight of 403.61 g/mol. Its IUPAC name is 1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-16-[[2-hydroxyethyl(methyl)amino]methyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-16-[[2-hydroxyethyl(methyl)amino]methyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 100985757 |
| Molecular Formula | C25H41NO3 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | 1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-16-[[2-hydroxyethyl(methyl)amino]methyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@H]1C(CN(C)CCO)C[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H41NO3/c1-16(28)23-17(15-26(4)11-12-27)13-22-20-6-5-18-14-19(29)7-9-24(18,2)21(20)8-10-25(22,23)3/h5,17,19-23,27,29H,6-15H2,1-4H3/t17?,19-,20+,21-,22-,23-,24-,25-/m0/s1 |
| InChIKey | JOOHVTZMFOZTQP-XMNBTCQSSA-N |
| XLogP | 3.67 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|