C25H41O5P — CID 99571530
1-[(3S,8S,9S,10R,13S,14S,16R,17S)-16-diethoxyphosphoryl-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 99571530) has the molecular formula C25H41O5P and a molecular weight of 452.57 g/mol. Its IUPAC name is 1-[(3S,8S,9S,10R,13S,14S,16R,17S)-16-diethoxyphosphoryl-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3S,8S,9S,10R,13S,14S,16R,17S)-16-diethoxyphosphoryl-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 99571530 |
| Molecular Formula | C25H41O5P |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 1-[(3S,8S,9S,10R,13S,14S,16R,17S)-16-diethoxyphosphoryl-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CCOP(=O)(OCC)[C@@H]1C[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]2(C)[C@H]1C(C)=O |
| InChI | InChI=1S/C25H41O5P/c1-6-29-31(28,30-7-2)22-15-21-19-9-8-17-14-18(27)10-12-24(17,4)20(19)11-13-25(21,5)23(22)16(3)26/h8,18-23,27H,6-7,9-15H2,1-5H3/t18-,19+,20-,21-,22+,23-,24-,25-/m0/s1 |
| InChIKey | PAGAUXDBGHRKRS-DWKSCWABSA-N |
| XLogP | 5.76 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|