C16H22N2O8 — CID 100986214
diethyl 2-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-ylidene]propanedioate (PubChem CID 100986214) has the molecular formula C16H22N2O8 and a molecular weight of 370.36 g/mol. Its IUPAC name is diethyl 2-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-ylidene]propanedioate.
| Compound Name | diethyl 2-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-ylidene]propanedioate |
|---|---|
| PubChem CID | 100986214 |
| Molecular Formula | C16H22N2O8 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | diethyl 2-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-ylidene]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)=C1C=CN([C@H]2C[C@H](O)[C@@H](CO)O2)C(=O)N1 |
| InChI | InChI=1S/C16H22N2O8/c1-3-24-14(21)13(15(22)25-4-2)9-5-6-18(16(23)17-9)12-7-10(20)11(8-19)26-12/h5-6,10-12,19-20H,3-4,7-8H2,1-2H3,(H,17,23)/t10-,11+,12+/m0/s1 |
| InChIKey | UVJNVMJDVDKHHG-QJPTWQEYSA-N |
| XLogP | -0.63 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|