C23H33N3O2 — CID 100988974
(5R)-4-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-3-phenyl-1-oxa-2,4-diazaspiro[4.5]deca-2,6-diene (PubChem CID 100988974) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is (5R)-4-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-3-phenyl-1-oxa-2,4-diazaspiro[4.5]deca-2,6-diene.
| Compound Name | (5R)-4-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-3-phenyl-1-oxa-2,4-diazaspiro[4.5]deca-2,6-diene |
|---|---|
| PubChem CID | 100988974 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | (5R)-4-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-3-phenyl-1-oxa-2,4-diazaspiro[4.5]deca-2,6-diene |
| SMILES | CCC(CC)(OC)[C@@H]1CCCN1N1C(c2ccccc2)=NO[C@]12C=CCCC2 |
| InChI | InChI=1S/C23H33N3O2/c1-4-22(5-2,27-3)20-15-12-18-25(20)26-21(19-13-8-6-9-14-19)24-28-23(26)16-10-7-11-17-23/h6,8-10,13-14,16,20H,4-5,7,11-12,15,17-18H2,1-3H3/t20-,23-/m0/s1 |
| InChIKey | OTTBBMVSNOIIFE-REWPJTCUSA-N |
| XLogP | 4.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|