C31H33N3O2 — CID 100988975
(5R)-4-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-3-phenyl-1-oxa-2,4-diazaspiro[4.5]deca-2,6-diene (PubChem CID 100988975) has the molecular formula C31H33N3O2 and a molecular weight of 479.62 g/mol. Its IUPAC name is (5R)-4-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-3-phenyl-1-oxa-2,4-diazaspiro[4.5]deca-2,6-diene.
| Compound Name | (5R)-4-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-3-phenyl-1-oxa-2,4-diazaspiro[4.5]deca-2,6-diene |
|---|---|
| PubChem CID | 100988975 |
| Molecular Formula | C31H33N3O2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | (5R)-4-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-3-phenyl-1-oxa-2,4-diazaspiro[4.5]deca-2,6-diene |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@@H]1CCCN1N1C(c2ccccc2)=NO[C@]12C=CCCC2 |
| InChI | InChI=1S/C31H33N3O2/c1-35-31(26-17-8-3-9-18-26,27-19-10-4-11-20-27)28-21-14-24-33(28)34-29(25-15-6-2-7-16-25)32-36-30(34)22-12-5-13-23-30/h2-4,6-12,15-20,22,28H,5,13-14,21,23-24H2,1H3/t28-,30-/m0/s1 |
| InChIKey | RFAOWYARELQYBD-JDXGNMNLSA-N |
| XLogP | 6.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|