C21H12Cl4N2O4 — CID 100992521
3,3'-bis(2,6-dichlorophenyl)-7'-methylspiro[1,4,2-dioxazole-5,5'-3a,7a-dihydro-1,2-benzoxazole]-4'-one (PubChem CID 100992521) has the molecular formula C21H12Cl4N2O4 and a molecular weight of 498.15 g/mol. Its IUPAC name is 3,3'-bis(2,6-dichlorophenyl)-7'-methylspiro[1,4,2-dioxazole-5,5'-3a,7a-dihydro-1,2-benzoxazole]-4'-one.
| Compound Name | 3,3'-bis(2,6-dichlorophenyl)-7'-methylspiro[1,4,2-dioxazole-5,5'-3a,7a-dihydro-1,2-benzoxazole]-4'-one |
|---|---|
| PubChem CID | 100992521 |
| Molecular Formula | C21H12Cl4N2O4 |
| Molecular Weight | 498.15 g/mol |
| Exact Mass | 495.96 |
| IUPAC Name | 3,3'-bis(2,6-dichlorophenyl)-7'-methylspiro[1,4,2-dioxazole-5,5'-3a,7a-dihydro-1,2-benzoxazole]-4'-one |
| SMILES | CC1=CC2(ON=C(c3c(Cl)cccc3Cl)O2)C(=O)C2C(c3c(Cl)cccc3Cl)=NOC12 |
| InChI | InChI=1S/C21H12Cl4N2O4/c1-9-8-21(29-20(27-31-21)15-12(24)6-3-7-13(15)25)19(28)16-17(26-30-18(9)16)14-10(22)4-2-5-11(14)23/h2-8,16,18H,1H3 |
| InChIKey | ZEFUINVCRCIRDH-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.15 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|