C21H12Cl4N2O5 — CID 100992519
3,3'-bis(2,6-dichlorophenyl)-7'a-methoxyspiro[1,4,2-dioxazole-5,6'-3aH-1,2-benzoxazole]-7'-one (PubChem CID 100992519) has the molecular formula C21H12Cl4N2O5 and a molecular weight of 514.15 g/mol. Its IUPAC name is 3,3'-bis(2,6-dichlorophenyl)-7'a-methoxyspiro[1,4,2-dioxazole-5,6'-3aH-1,2-benzoxazole]-7'-one.
| Compound Name | 3,3'-bis(2,6-dichlorophenyl)-7'a-methoxyspiro[1,4,2-dioxazole-5,6'-3aH-1,2-benzoxazole]-7'-one |
|---|---|
| PubChem CID | 100992519 |
| Molecular Formula | C21H12Cl4N2O5 |
| Molecular Weight | 514.15 g/mol |
| Exact Mass | 511.95 |
| IUPAC Name | 3,3'-bis(2,6-dichlorophenyl)-7'a-methoxyspiro[1,4,2-dioxazole-5,6'-3aH-1,2-benzoxazole]-7'-one |
| SMILES | COC12ON=C(c3c(Cl)cccc3Cl)C1C=CC1(ON=C(c3c(Cl)cccc3Cl)O1)C2=O |
| InChI | InChI=1S/C21H12Cl4N2O5/c1-29-21-10(17(26-32-21)15-11(22)4-2-5-12(15)23)8-9-20(19(21)28)30-18(27-31-20)16-13(24)6-3-7-14(16)25/h2-10H,1H3 |
| InChIKey | WMFZWWFKPDNUKB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.15 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|