C42H50Br2O4 — CID 100992656
25,27-bis(bromomethyl)-5,17,26,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene (PubChem CID 100992656) has the molecular formula C42H50Br2O4 and a molecular weight of 778.67 g/mol. Its IUPAC name is 25,27-bis(bromomethyl)-5,17,26,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene.
| Compound Name | 25,27-bis(bromomethyl)-5,17,26,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene |
|---|---|
| PubChem CID | 100992656 |
| Molecular Formula | C42H50Br2O4 |
| Molecular Weight | 778.67 g/mol |
| Exact Mass | 776.21 |
| IUPAC Name | 25,27-bis(bromomethyl)-5,17,26,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene |
| SMILES | CCCOc1cc2c(OCCC)c(c1)Cc1cccc(c1CBr)Cc1cc(OCCC)cc(c1OCCC)Cc1cccc(c1CBr)C2 |
| InChI | InChI=1S/C42H50Br2O4/c1-5-15-45-37-23-33-19-29-11-9-13-31(39(29)27-43)21-35-25-38(46-16-6-2)26-36(42(35)48-18-8-4)22-32-14-10-12-30(40(32)28-44)20-34(24-37)41(33)47-17-7-3/h9-14,23-26H,5-8,15-22,27-28H2,1-4H3 |
| InChIKey | DIFQVHVJCOSTJQ-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.67 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|