C48H54Br2O4 — CID 25214111
5,11-dibromo-17-(3,5-dimethylphenyl)-25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene (PubChem CID 25214111) has the molecular formula C48H54Br2O4 and a molecular weight of 854.76 g/mol. Its IUPAC name is 5,11-dibromo-17-(3,5-dimethylphenyl)-25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene.
| Compound Name | 5,11-dibromo-17-(3,5-dimethylphenyl)-25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene |
|---|---|
| PubChem CID | 25214111 |
| Molecular Formula | C48H54Br2O4 |
| Molecular Weight | 854.76 g/mol |
| Exact Mass | 852.24 |
| IUPAC Name | 5,11-dibromo-17-(3,5-dimethylphenyl)-25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene |
| SMILES | CCCOc1c2cccc1Cc1cc(-c3cc(C)cc(C)c3)cc(c1OCCC)Cc1cc(Br)cc(c1OCCC)Cc1cc(Br)cc(c1OCCC)C2 |
| InChI | InChI=1S/C48H54Br2O4/c1-7-14-51-45-33-12-11-13-34(45)22-39-27-43(49)29-41(47(39)53-16-9-3)26-42-30-44(50)28-40(48(42)54-17-10-4)25-38-24-36(35-19-31(5)18-32(6)20-35)23-37(21-33)46(38)52-15-8-2/h11-13,18-20,23-24,27-30H,7-10,14-17,21-22,25-26H2,1-6H3 |
| InChIKey | YQIPUWRZTSUXKP-UHFFFAOYSA-N |
| XLogP | 13.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.76 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |