C46H62Br2O4Si2 — CID 121199260
(11,23-dibromo-25,26,27,28-tetrapropoxy-17-trimethylsilyl-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)-trimethylsilane (PubChem CID 121199260) has the molecular formula C46H62Br2O4Si2 and a molecular weight of 894.98 g/mol. Its IUPAC name is (11,23-dibromo-25,26,27,28-tetrapropoxy-17-trimethylsilyl-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)-trimethylsilane.
| Compound Name | (11,23-dibromo-25,26,27,28-tetrapropoxy-17-trimethylsilyl-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)-trimethylsilane |
|---|---|
| PubChem CID | 121199260 |
| Molecular Formula | C46H62Br2O4Si2 |
| Molecular Weight | 894.98 g/mol |
| Exact Mass | 892.26 |
| IUPAC Name | (11,23-dibromo-25,26,27,28-tetrapropoxy-17-trimethylsilyl-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)-trimethylsilane |
| SMILES | CCCOc1c2cc(Br)cc1Cc1cc([Si](C)(C)C)cc(c1OCCC)Cc1cc(Br)cc(c1OCCC)Cc1cc([Si](C)(C)C)cc(c1OCCC)C2 |
| InChI | InChI=1S/C46H62Br2O4Si2/c1-11-15-49-43-31-19-35-27-41(53(5,6)7)29-37(45(35)51-17-13-3)21-33-25-40(48)26-34(44(33)50-16-12-2)22-38-30-42(54(8,9)10)28-36(46(38)52-18-14-4)20-32(43)24-39(47)23-31/h23-30H,11-22H2,1-10H3 |
| InChIKey | GYARFBYNXJLBAE-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.98 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|