C28H29NO2S — CID 100993901
5-hydroxy-5-methyl-3,4-diphenyl-1-(5-phenylsulfanylpentyl)pyrrol-2-one (PubChem CID 100993901) has the molecular formula C28H29NO2S and a molecular weight of 443.61 g/mol. Its IUPAC name is 5-hydroxy-5-methyl-3,4-diphenyl-1-(5-phenylsulfanylpentyl)pyrrol-2-one.
| Compound Name | 5-hydroxy-5-methyl-3,4-diphenyl-1-(5-phenylsulfanylpentyl)pyrrol-2-one |
|---|---|
| PubChem CID | 100993901 |
| Molecular Formula | C28H29NO2S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 5-hydroxy-5-methyl-3,4-diphenyl-1-(5-phenylsulfanylpentyl)pyrrol-2-one |
| SMILES | CC1(O)C(c2ccccc2)=C(c2ccccc2)C(=O)N1CCCCCSc1ccccc1 |
| InChI | InChI=1S/C28H29NO2S/c1-28(31)26(23-16-8-3-9-17-23)25(22-14-6-2-7-15-22)27(30)29(28)20-12-5-13-21-32-24-18-10-4-11-19-24/h2-4,6-11,14-19,31H,5,12-13,20-21H2,1H3 |
| InChIKey | SIMHDJQQLSHIAB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|