C26H25NO2 — CID 10221580
1-butyl-5-hydroxy-3,4,5-triphenylpyrrol-2-one (PubChem CID 10221580) has the molecular formula C26H25NO2 and a molecular weight of 383.49 g/mol. Its IUPAC name is 1-butyl-5-hydroxy-3,4,5-triphenylpyrrol-2-one.
| Compound Name | 1-butyl-5-hydroxy-3,4,5-triphenylpyrrol-2-one |
|---|---|
| PubChem CID | 10221580 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 1-butyl-5-hydroxy-3,4,5-triphenylpyrrol-2-one |
| SMILES | CCCCN1C(=O)C(c2ccccc2)=C(c2ccccc2)C1(O)c1ccccc1 |
| InChI | InChI=1S/C26H25NO2/c1-2-3-19-27-25(28)23(20-13-7-4-8-14-20)24(21-15-9-5-10-16-21)26(27,29)22-17-11-6-12-18-22/h4-18,29H,2-3,19H2,1H3 |
| InChIKey | YUXDKARSZDIMAI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|