C15H22BrNO — CID 100993923
(1S,2S,5R)-1-(6-bromo-2-pyridinyl)-5-methyl-2-propan-2-ylcyclohexan-1-ol (PubChem CID 100993923) has the molecular formula C15H22BrNO and a molecular weight of 312.25 g/mol. Its IUPAC name is (1S,2S,5R)-1-(6-bromo-2-pyridinyl)-5-methyl-2-propan-2-ylcyclohexan-1-ol.
| Compound Name | (1S,2S,5R)-1-(6-bromo-2-pyridinyl)-5-methyl-2-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 100993923 |
| Molecular Formula | C15H22BrNO |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | (1S,2S,5R)-1-(6-bromo-2-pyridinyl)-5-methyl-2-propan-2-ylcyclohexan-1-ol |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@@]1(O)c1cccc(Br)n1 |
| InChI | InChI=1S/C15H22BrNO/c1-10(2)12-8-7-11(3)9-15(12,18)13-5-4-6-14(16)17-13/h4-6,10-12,18H,7-9H2,1-3H3/t11-,12+,15+/m1/s1 |
| InChIKey | ZJDWNDGIZYBAOF-XUJVJEKNSA-N |
| XLogP | 4.12 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|