C17H23NO4 — CID 100995631
(3'aS,7'aS)-1'-benzyl-2,2-dimethylspiro[1,3-dioxolane-4,4'-3a,5,7,7a-tetrahydro-3H-pyrano[3,4-c][1,2]oxazole] (PubChem CID 100995631) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (3'aS,7'aS)-1'-benzyl-2,2-dimethylspiro[1,3-dioxolane-4,4'-3a,5,7,7a-tetrahydro-3H-pyrano[3,4-c][1,2]oxazole].
| Compound Name | (3'aS,7'aS)-1'-benzyl-2,2-dimethylspiro[1,3-dioxolane-4,4'-3a,5,7,7a-tetrahydro-3H-pyrano[3,4-c][1,2]oxazole] |
|---|---|
| PubChem CID | 100995631 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (3'aS,7'aS)-1'-benzyl-2,2-dimethylspiro[1,3-dioxolane-4,4'-3a,5,7,7a-tetrahydro-3H-pyrano[3,4-c][1,2]oxazole] |
| SMILES | CC1(C)OCC2(COC[C@@H]3[C@H]2CON3Cc2ccccc2)O1 |
| InChI | InChI=1S/C17H23NO4/c1-16(2)20-12-17(22-16)11-19-10-15-14(17)9-21-18(15)8-13-6-4-3-5-7-13/h3-7,14-15H,8-12H2,1-2H3/t14-,15-,17?/m1/s1 |
| InChIKey | HQYUHKRFPHTDAN-BLBXNVQISA-N |
| XLogP | 1.97 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |