C23H37NaO9 — CID 100997397
sodium (3R,5R)-7-[(1S,2R,3S,5R,6S,8S,8aR)-3,5,6-trihydroxy-2-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl]-3,5-dihydroxyheptanoate (PubChem CID 100997397) has the molecular formula C23H37NaO9 and a molecular weight of 480.53 g/mol. Its IUPAC name is sodium (3R,5R)-7-[(1S,2R,3S,5R,6S,8S,8aR)-3,5,6-trihydroxy-2-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl]-3,5-dihydroxyheptanoate.
| Compound Name | sodium (3R,5R)-7-[(1S,2R,3S,5R,6S,8S,8aR)-3,5,6-trihydroxy-2-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl]-3,5-dihydroxyheptanoate |
|---|---|
| PubChem CID | 100997397 |
| Molecular Formula | C23H37NaO9 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | sodium (3R,5R)-7-[(1S,2R,3S,5R,6S,8S,8aR)-3,5,6-trihydroxy-2-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl]-3,5-dihydroxyheptanoate |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@H](O)[C@H](O)C2=C[C@@H](O)[C@H](C)[C@H](CC[C@@H](O)C[C@@H](O)CC(=O)[O-])[C@H]21.[Na+] |
| InChI | InChI=1S/C23H38O9.Na/c1-4-11(2)23(31)32-19-10-18(27)22(30)16-9-17(26)12(3)15(21(16)19)6-5-13(24)7-14(25)8-20(28)29;/h9,11-15,17-19,21-22,24-27,30H,4-8,10H2,1-3H3,(H,28,29);/q;+1/p-1/t11-,12+,13+,14+,15-,17+,18-,19-,21+,22+;/m0./s1 |
| InChIKey | OTLYYSVULBGQFJ-KFVMSNASSA-M |
| XLogP | -3.72 |
| TPSA | 167.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|