C23H36FNaO7 — CID 143811066
sodium;[(1S,6S,7R,8S,8aR)-8-(2-fluoroethyl)-6-hydroxy-7-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate;(3R)-3,5-dihydroxypentanoate (PubChem CID 143811066) has the molecular formula C23H36FNaO7 and a molecular weight of 466.52 g/mol. Its IUPAC name is sodium;[(1S,6S,7R,8S,8aR)-8-(2-fluoroethyl)-6-hydroxy-7-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate;(3R)-3,5-dihydroxypentanoate.
| Compound Name | sodium;[(1S,6S,7R,8S,8aR)-8-(2-fluoroethyl)-6-hydroxy-7-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate;(3R)-3,5-dihydroxypentanoate |
|---|---|
| PubChem CID | 143811066 |
| Molecular Formula | C23H36FNaO7 |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | sodium;[(1S,6S,7R,8S,8aR)-8-(2-fluoroethyl)-6-hydroxy-7-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate;(3R)-3,5-dihydroxypentanoate |
| SMILES | CC[C@H](C)C(=O)O[C@H]1CC=CC2=C[C@@H](O)[C@H](C)[C@H](CCF)[C@H]21.O=C([O-])C[C@H](O)CCO.[Na+] |
| InChI | InChI=1S/C18H27FO3.C5H10O4.Na/c1-4-11(2)18(21)22-16-7-5-6-13-10-15(20)12(3)14(8-9-19)17(13)16;6-2-1-4(7)3-5(8)9;/h5-6,10-12,14-17,20H,4,7-9H2,1-3H3;4,6-7H,1-3H2,(H,8,9);/q;;+1/p-1/t11-,12+,14-,15+,16-,17-;4-;/m01./s1 |
| InChIKey | RUKUSCNHTPJMAH-KRYBBDFBSA-M |
| XLogP | -1.69 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |