C24H38O6 — CID 58819836
5-hydroxy-7-[6-hydroxy-2-methyl-8-(2-methylbutanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3-methylheptanoic acid (PubChem CID 58819836) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is 5-hydroxy-7-[6-hydroxy-2-methyl-8-(2-methylbutanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3-methylheptanoic acid.
| Compound Name | 5-hydroxy-7-[6-hydroxy-2-methyl-8-(2-methylbutanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3-methylheptanoic acid |
|---|---|
| PubChem CID | 58819836 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 5-hydroxy-7-[6-hydroxy-2-methyl-8-(2-methylbutanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3-methylheptanoic acid |
| SMILES | CCC(C)C(=O)OC1CC(O)C=C2C=CC(C)C(CCC(O)CC(C)CC(=O)O)C21 |
| InChI | InChI=1S/C24H38O6/c1-5-15(3)24(29)30-21-13-19(26)12-17-7-6-16(4)20(23(17)21)9-8-18(25)10-14(2)11-22(27)28/h6-7,12,14-16,18-21,23,25-26H,5,8-11,13H2,1-4H3,(H,27,28) |
| InChIKey | ZPIAARVHRONGMP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |