C24H38O7 — CID 70884184
3-hydroxy-7-[6-hydroxy-2-methyl-8-(2-methylbutanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-5-methoxyheptanoic acid (PubChem CID 70884184) has the molecular formula C24H38O7 and a molecular weight of 438.56 g/mol. Its IUPAC name is 3-hydroxy-7-[6-hydroxy-2-methyl-8-(2-methylbutanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-5-methoxyheptanoic acid.
| Compound Name | 3-hydroxy-7-[6-hydroxy-2-methyl-8-(2-methylbutanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-5-methoxyheptanoic acid |
|---|---|
| PubChem CID | 70884184 |
| Molecular Formula | C24H38O7 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 3-hydroxy-7-[6-hydroxy-2-methyl-8-(2-methylbutanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-5-methoxyheptanoic acid |
| SMILES | CCC(C)C(=O)OC1CC(O)C=C2C=CC(C)C(CCC(CC(O)CC(=O)O)OC)C21 |
| InChI | InChI=1S/C24H38O7/c1-5-14(2)24(29)31-21-12-17(25)10-16-7-6-15(3)20(23(16)21)9-8-19(30-4)11-18(26)13-22(27)28/h6-7,10,14-15,17-21,23,25-26H,5,8-9,11-13H2,1-4H3,(H,27,28) |
| InChIKey | KMESHCIOOTVRGG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |