C24H38BNO8Y — CID 164935620
CID 164935620 (PubChem CID 164935620) has the molecular formula C24H38BNO8Y and a molecular weight of 568.29 g/mol.
| Compound Name | CID 164935620 |
|---|---|
| PubChem CID | 164935620 |
| Molecular Formula | C24H38BNO8Y |
| Molecular Weight | 568.29 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | — |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@H](O)C=C2C=C[C@H](C)[C@H](CC[C@@H](O)C[C@@H](O)CC(=O)O)[C@H]21.[H]/N=C(\[B])O.[Y] |
| InChI | InChI=1S/C23H36O7.CH2BNO.Y/c1-4-13(2)23(29)30-20-11-17(25)9-15-6-5-14(3)19(22(15)20)8-7-16(24)10-18(26)12-21(27)28;2-1(3)4;/h5-6,9,13-14,16-20,22,24-26H,4,7-8,10-12H2,1-3H3,(H,27,28);(H2,3,4);/t13-,14-,16+,17+,18+,19-,20-,22-;;/m0../s1 |
| InChIKey | AVUALSPSOFORKN-HLQZVYNXSA-N |
| XLogP | 2.09 |
| TPSA | 168.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|