C26H41NaO4 — CID 58633666
sodium (5R)-7-[(2S,6S,8S,8aR)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dimethylheptanoate (PubChem CID 58633666) has the molecular formula C26H41NaO4 and a molecular weight of 440.60 g/mol. Its IUPAC name is sodium (5R)-7-[(2S,6S,8S,8aR)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dimethylheptanoate.
| Compound Name | sodium (5R)-7-[(2S,6S,8S,8aR)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dimethylheptanoate |
|---|---|
| PubChem CID | 58633666 |
| Molecular Formula | C26H41NaO4 |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | sodium (5R)-7-[(2S,6S,8S,8aR)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dimethylheptanoate |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@H](C)C=C2C=C[C@H](C)C(CC[C@@H](C)CC(C)CC(=O)[O-])[C@H]21.[Na+] |
| InChI | InChI=1S/C26H42O4.Na/c1-7-19(5)26(29)30-23-14-18(4)13-21-10-9-20(6)22(25(21)23)11-8-16(2)12-17(3)15-24(27)28;/h9-10,13,16-20,22-23,25H,7-8,11-12,14-15H2,1-6H3,(H,27,28);/q;+1/p-1/t16-,17?,18-,19+,20+,22?,23+,25+;/m1./s1 |
| InChIKey | XNZYJIAGZVVLHZ-FJVZRUHCSA-M |
| XLogP | 1.94 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |